C16H12N4O3S — CID 87944419
1-(1,3-benzoxazol-4-yl)-3-(5-cyano-2-methoxyphenyl)sulfanylurea (PubChem CID 87944419) has the molecular formula C16H12N4O3S and a molecular weight of 340.36 g/mol. Its IUPAC name is 1-(1,3-benzoxazol-4-yl)-3-(5-cyano-2-methoxyphenyl)sulfanylurea.
| Compound Name | 1-(1,3-benzoxazol-4-yl)-3-(5-cyano-2-methoxyphenyl)sulfanylurea |
|---|---|
| PubChem CID | 87944419 |
| Molecular Formula | C16H12N4O3S |
| Molecular Weight | 340.36 g/mol |
| Exact Mass | 340.06 |
| IUPAC Name | 1-(1,3-benzoxazol-4-yl)-3-(5-cyano-2-methoxyphenyl)sulfanylurea |
| SMILES | COc1ccc(C#N)cc1SNC(=O)Nc1cccc2ocnc12 |
| InChI | InChI=1S/C16H12N4O3S/c1-22-12-6-5-10(8-17)7-14(12)24-20-16(21)19-11-3-2-4-13-15(11)18-9-23-13/h2-7,9H,1H3,(H2,19,20,21) |
| InChIKey | BEQCFWANNUKJRH-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 100.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.36 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|