C17H14BrNS — CID 116622070
6-bromo-1-(2,3-dihydro-1-benzothiophen-3-ylmethyl)indole (PubChem CID 116622070) has the molecular formula C17H14BrNS and a molecular weight of 344.28 g/mol. Its IUPAC name is 6-bromo-1-(2,3-dihydro-1-benzothiophen-3-ylmethyl)indole.
| Compound Name | 6-bromo-1-(2,3-dihydro-1-benzothiophen-3-ylmethyl)indole |
|---|---|
| PubChem CID | 116622070 |
| Molecular Formula | C17H14BrNS |
| Molecular Weight | 344.28 g/mol |
| Exact Mass | 343.00 |
| IUPAC Name | 6-bromo-1-(2,3-dihydro-1-benzothiophen-3-ylmethyl)indole |
| SMILES | Brc1ccc2ccn(CC3CSc4ccccc43)c2c1 |
| InChI | InChI=1S/C17H14BrNS/c18-14-6-5-12-7-8-19(16(12)9-14)10-13-11-20-17-4-2-1-3-15(13)17/h1-9,13H,10-11H2 |
| InChIKey | HOWZIPIADOTPBR-UHFFFAOYSA-N |
| XLogP | 5.29 |
| TPSA | 4.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.28 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |