C7H10F2N2O — CID 116624360
1-(2,2-difluoroethyl)-3-ethylimidazol-2-one (PubChem CID 116624360) has the molecular formula C7H10F2N2O and a molecular weight of 176.17 g/mol. Its IUPAC name is 1-(2,2-difluoroethyl)-3-ethylimidazol-2-one.
| Compound Name | 1-(2,2-difluoroethyl)-3-ethylimidazol-2-one |
|---|---|
| PubChem CID | 116624360 |
| Molecular Formula | C7H10F2N2O |
| Molecular Weight | 176.17 g/mol |
| Exact Mass | 176.08 |
| IUPAC Name | 1-(2,2-difluoroethyl)-3-ethylimidazol-2-one |
| SMILES | CCn1ccn(CC(F)F)c1=O |
| InChI | InChI=1S/C7H10F2N2O/c1-2-10-3-4-11(7(10)12)5-6(8)9/h3-4,6H,2,5H2,1H3 |
| InChIKey | FPOJDZFSAWWKFJ-UHFFFAOYSA-N |
| XLogP | 0.93 |
| TPSA | 26.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 176.17 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |