C10H16F3N3OS — CID 116627160
2-methoxy-N-[[1-[2-(trifluoromethylsulfanyl)ethyl]pyrazol-3-yl]methyl]ethanamine (PubChem CID 116627160) has the molecular formula C10H16F3N3OS and a molecular weight of 283.32 g/mol. Its IUPAC name is 2-methoxy-N-[[1-[2-(trifluoromethylsulfanyl)ethyl]pyrazol-3-yl]methyl]ethanamine.
| Compound Name | 2-methoxy-N-[[1-[2-(trifluoromethylsulfanyl)ethyl]pyrazol-3-yl]methyl]ethanamine |
|---|---|
| PubChem CID | 116627160 |
| Molecular Formula | C10H16F3N3OS |
| Molecular Weight | 283.32 g/mol |
| Exact Mass | 283.10 |
| IUPAC Name | 2-methoxy-N-[[1-[2-(trifluoromethylsulfanyl)ethyl]pyrazol-3-yl]methyl]ethanamine |
| SMILES | COCCNCc1ccn(CCSC(F)(F)F)n1 |
| InChI | InChI=1S/C10H16F3N3OS/c1-17-6-3-14-8-9-2-4-16(15-9)5-7-18-10(11,12)13/h2,4,14H,3,5-8H2,1H3 |
| InChIKey | BTPACRUPOZKSNH-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 39.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.32 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|