C12H19F2N3O — CID 116637538
[1-[[1-(difluoromethyl)imidazol-2-yl]methyl]azepan-2-yl]methanol (PubChem CID 116637538) has the molecular formula C12H19F2N3O and a molecular weight of 259.30 g/mol. Its IUPAC name is [1-[[1-(difluoromethyl)imidazol-2-yl]methyl]azepan-2-yl]methanol.
| Compound Name | [1-[[1-(difluoromethyl)imidazol-2-yl]methyl]azepan-2-yl]methanol |
|---|---|
| PubChem CID | 116637538 |
| Molecular Formula | C12H19F2N3O |
| Molecular Weight | 259.30 g/mol |
| Exact Mass | 259.15 |
| IUPAC Name | [1-[[1-(difluoromethyl)imidazol-2-yl]methyl]azepan-2-yl]methanol |
| SMILES | OCC1CCCCCN1Cc1nccn1C(F)F |
| InChI | InChI=1S/C12H19F2N3O/c13-12(14)17-7-5-15-11(17)8-16-6-3-1-2-4-10(16)9-18/h5,7,10,12,18H,1-4,6,8-9H2 |
| InChIKey | HRLOOXKUBNXLMF-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 41.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.30 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |