C27H54OSiSn — CID 11663878
tert-butyl-dimethyl-[(E,3S,4S)-4-methyl-1-tributylstannyloct-1-en-6-yn-3-yl]oxysilane (PubChem CID 11663878) has the molecular formula C27H54OSiSn and a molecular weight of 541.53 g/mol. Its IUPAC name is tert-butyl-dimethyl-[(E,3S,4S)-4-methyl-1-tributylstannyloct-1-en-6-yn-3-yl]oxysilane.
| Compound Name | tert-butyl-dimethyl-[(E,3S,4S)-4-methyl-1-tributylstannyloct-1-en-6-yn-3-yl]oxysilane |
|---|---|
| PubChem CID | 11663878 |
| Molecular Formula | C27H54OSiSn |
| Molecular Weight | 541.53 g/mol |
| Exact Mass | 542.30 |
| IUPAC Name | tert-butyl-dimethyl-[(E,3S,4S)-4-methyl-1-tributylstannyloct-1-en-6-yn-3-yl]oxysilane |
| SMILES | CC#CC[C@H](C)[C@@H](/C=C/[Sn](CCCC)(CCCC)CCCC)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C15H27OSi.3C4H9.Sn/c1-9-11-12-13(3)14(10-2)16-17(7,8)15(4,5)6;3*1-3-4-2;/h2,10,13-14H,12H2,1,3-8H3;3*1,3-4H2,2H3;/t13-,14+;;;;/m0..../s1 |
| InChIKey | GBCWKXQKBRUICS-CIGCOMLQSA-N |
| XLogP | 9.37 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 30 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.53 |
| LogP ≤ 5 | 9.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|