C10H9F3N4 — CID 116641604
2-[1-(3,4,5-trifluorophenyl)triazol-4-yl]ethanamine (PubChem CID 116641604) has the molecular formula C10H9F3N4 and a molecular weight of 242.20 g/mol. Its IUPAC name is 2-[1-(3,4,5-trifluorophenyl)triazol-4-yl]ethanamine.
| Compound Name | 2-[1-(3,4,5-trifluorophenyl)triazol-4-yl]ethanamine |
|---|---|
| PubChem CID | 116641604 |
| Molecular Formula | C10H9F3N4 |
| Molecular Weight | 242.20 g/mol |
| Exact Mass | 242.08 |
| IUPAC Name | 2-[1-(3,4,5-trifluorophenyl)triazol-4-yl]ethanamine |
| SMILES | NCCc1cn(-c2cc(F)c(F)c(F)c2)nn1 |
| InChI | InChI=1S/C10H9F3N4/c11-8-3-7(4-9(12)10(8)13)17-5-6(1-2-14)15-16-17/h3-5H,1-2,14H2 |
| InChIKey | SZNLLYQUGWWOFL-UHFFFAOYSA-N |
| XLogP | 1.19 |
| TPSA | 56.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.20 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|