C8H5F3N4 — CID 79507454
1-(3,4,5-trifluorophenyl)triazol-4-amine (PubChem CID 79507454) has the molecular formula C8H5F3N4 and a molecular weight of 214.15 g/mol. Its IUPAC name is 1-(3,4,5-trifluorophenyl)triazol-4-amine.
| Compound Name | 1-(3,4,5-trifluorophenyl)triazol-4-amine |
|---|---|
| PubChem CID | 79507454 |
| Molecular Formula | C8H5F3N4 |
| Molecular Weight | 214.15 g/mol |
| Exact Mass | 214.05 |
| IUPAC Name | 1-(3,4,5-trifluorophenyl)triazol-4-amine |
| SMILES | Nc1cn(-c2cc(F)c(F)c(F)c2)nn1 |
| InChI | InChI=1S/C8H5F3N4/c9-5-1-4(2-6(10)8(5)11)15-3-7(12)13-14-15/h1-3H,12H2 |
| InChIKey | RSVIGAFUOZKGRU-UHFFFAOYSA-N |
| XLogP | 1.27 |
| TPSA | 56.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.15 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|