C10H6F3N3O2 — CID 122241205
methyl 1-(3,4,5-trifluorophenyl)triazole-4-carboxylate (PubChem CID 122241205) has the molecular formula C10H6F3N3O2 and a molecular weight of 257.17 g/mol. Its IUPAC name is methyl 1-(3,4,5-trifluorophenyl)triazole-4-carboxylate.
| Compound Name | methyl 1-(3,4,5-trifluorophenyl)triazole-4-carboxylate |
|---|---|
| PubChem CID | 122241205 |
| Molecular Formula | C10H6F3N3O2 |
| Molecular Weight | 257.17 g/mol |
| Exact Mass | 257.04 |
| IUPAC Name | methyl 1-(3,4,5-trifluorophenyl)triazole-4-carboxylate |
| SMILES | COC(=O)c1cn(-c2cc(F)c(F)c(F)c2)nn1 |
| InChI | InChI=1S/C10H6F3N3O2/c1-18-10(17)8-4-16(15-14-8)5-2-6(11)9(13)7(12)3-5/h2-4H,1H3 |
| InChIKey | UHQKNNBQCLENLQ-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 57.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.17 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|