C32H64O7Si3 — CID 11664603
methyl 2-[(2S,3R,4S,4aS,6R,8aS)-3,4-bis(triethylsilyloxy)-2-[(1S)-1-triethylsilyloxyprop-2-enyl]-2,3,4,4a,6,7,8,8a-octahydropyrano[3,2-b]pyran-6-yl]acetate (PubChem CID 11664603) has the molecular formula C32H64O7Si3 and a molecular weight of 645.12 g/mol. Its IUPAC name is methyl 2-[(2S,3R,4S,4aS,6R,8aS)-3,4-bis(triethylsilyloxy)-2-[(1S)-1-triethylsilyloxyprop-2-enyl]-2,3,4,4a,6,7,8,8a-octahydropyrano[3,2-b]pyran-6-yl]acetate.
| Compound Name | methyl 2-[(2S,3R,4S,4aS,6R,8aS)-3,4-bis(triethylsilyloxy)-2-[(1S)-1-triethylsilyloxyprop-2-enyl]-2,3,4,4a,6,7,8,8a-octahydropyrano[3,2-b]pyran-6-yl]acetate |
|---|---|
| PubChem CID | 11664603 |
| Molecular Formula | C32H64O7Si3 |
| Molecular Weight | 645.12 g/mol |
| Exact Mass | 644.40 |
| IUPAC Name | methyl 2-[(2S,3R,4S,4aS,6R,8aS)-3,4-bis(triethylsilyloxy)-2-[(1S)-1-triethylsilyloxyprop-2-enyl]-2,3,4,4a,6,7,8,8a-octahydropyrano[3,2-b]pyran-6-yl]acetate |
| SMILES | C=C[C@H](O[Si](CC)(CC)CC)[C@@H]1O[C@H]2CC[C@H](CC(=O)OC)O[C@@H]2[C@H](O[Si](CC)(CC)CC)[C@@H]1O[Si](CC)(CC)CC |
| InChI | InChI=1S/C32H64O7Si3/c1-12-26(37-40(13-2,14-3)15-4)29-31(38-41(16-5,17-6)18-7)32(39-42(19-8,20-9)21-10)30-27(36-29)23-22-25(35-30)24-28(33)34-11/h12,25-27,29-32H,1,13-24H2,2-11H3/t25-,26+,27+,29+,30+,31-,32+/m1/s1 |
| InChIKey | JBXUDINUUIIUNP-WXLSTTMOSA-N |
| XLogP | 8.22 |
| TPSA | 72.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 645.12 |
| LogP ≤ 5 | 8.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|