C9H12N4O — CID 116647952
4-amino-2-(1-methylcyclopropyl)pyrimidine-5-carboxamide (PubChem CID 116647952) has the molecular formula C9H12N4O and a molecular weight of 192.22 g/mol. Its IUPAC name is 4-amino-2-(1-methylcyclopropyl)pyrimidine-5-carboxamide.
| Compound Name | 4-amino-2-(1-methylcyclopropyl)pyrimidine-5-carboxamide |
|---|---|
| PubChem CID | 116647952 |
| Molecular Formula | C9H12N4O |
| Molecular Weight | 192.22 g/mol |
| Exact Mass | 192.10 |
| IUPAC Name | 4-amino-2-(1-methylcyclopropyl)pyrimidine-5-carboxamide |
| SMILES | CC1(c2ncc(C(N)=O)c(N)n2)CC1 |
| InChI | InChI=1S/C9H12N4O/c1-9(2-3-9)8-12-4-5(7(11)14)6(10)13-8/h4H,2-3H2,1H3,(H2,11,14)(H2,10,12,13) |
| InChIKey | WIUJUBGHTZRLMY-UHFFFAOYSA-N |
| XLogP | 0.21 |
| TPSA | 94.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.22 |
| LogP ≤ 5 | 0.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |