C29H28F3N5O5 — CID 1166481
(5S,7S)-N-(4-benzamido-2,5-diethoxyphenyl)-5-(furan-2-yl)-7-(trifluoromethyl)-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidine-2-carboxamide (PubChem CID 1166481) has the molecular formula C29H28F3N5O5 and a molecular weight of 583.57 g/mol. Its IUPAC name is (5S,7S)-N-(4-benzamido-2,5-diethoxyphenyl)-5-(furan-2-yl)-7-(trifluoromethyl)-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidine-2-carboxamide.
| Compound Name | (5S,7S)-N-(4-benzamido-2,5-diethoxyphenyl)-5-(furan-2-yl)-7-(trifluoromethyl)-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidine-2-carboxamide |
|---|---|
| PubChem CID | 1166481 |
| Molecular Formula | C29H28F3N5O5 |
| Molecular Weight | 583.57 g/mol |
| Exact Mass | 583.20 |
| IUPAC Name | (5S,7S)-N-(4-benzamido-2,5-diethoxyphenyl)-5-(furan-2-yl)-7-(trifluoromethyl)-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidine-2-carboxamide |
| SMILES | CCOc1cc(NC(=O)c2cc3n(n2)[C@H](C(F)(F)F)C[C@@H](c2ccco2)N3)c(OCC)cc1NC(=O)c1ccccc1 |
| InChI | InChI=1S/C29H28F3N5O5/c1-3-40-23-14-19(24(41-4-2)13-18(23)34-27(38)17-9-6-5-7-10-17)35-28(39)21-16-26-33-20(22-11-8-12-42-22)15-25(29(30,31)32)37(26)36-21/h5-14,16,20,25,33H,3-4,15H2,1-2H3,(H,34,38)(H,35,39)/t20-,25-/m0/s1 |
| InChIKey | DSHFGLPZPSKVKD-CPJSRVTESA-N |
| XLogP | 6.44 |
| TPSA | 119.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 583.57 |
| LogP ≤ 5 | 6.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |