C11H11IN4S — CID 116648917
N-(5-iodopyrimidin-2-yl)-4,5,6,7-tetrahydro-1,3-benzothiazol-2-amine (PubChem CID 116648917) has the molecular formula C11H11IN4S and a molecular weight of 358.21 g/mol. Its IUPAC name is N-(5-iodopyrimidin-2-yl)-4,5,6,7-tetrahydro-1,3-benzothiazol-2-amine.
| Compound Name | N-(5-iodopyrimidin-2-yl)-4,5,6,7-tetrahydro-1,3-benzothiazol-2-amine |
|---|---|
| PubChem CID | 116648917 |
| Molecular Formula | C11H11IN4S |
| Molecular Weight | 358.21 g/mol |
| Exact Mass | 357.97 |
| IUPAC Name | N-(5-iodopyrimidin-2-yl)-4,5,6,7-tetrahydro-1,3-benzothiazol-2-amine |
| SMILES | Ic1cnc(Nc2nc3c(s2)CCCC3)nc1 |
| InChI | InChI=1S/C11H11IN4S/c12-7-5-13-10(14-6-7)16-11-15-8-3-1-2-4-9(8)17-11/h5-6H,1-4H2,(H,13,14,15,16) |
| InChIKey | OESPPDGFEWDWRX-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 50.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.21 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|