C8H14IN5 — CID 116649452
N'-(2-aminoethyl)-N'-(5-iodopyrimidin-2-yl)ethane-1,2-diamine (PubChem CID 116649452) has the molecular formula C8H14IN5 and a molecular weight of 307.14 g/mol. Its IUPAC name is N'-(2-aminoethyl)-N'-(5-iodopyrimidin-2-yl)ethane-1,2-diamine.
| Compound Name | N'-(2-aminoethyl)-N'-(5-iodopyrimidin-2-yl)ethane-1,2-diamine |
|---|---|
| PubChem CID | 116649452 |
| Molecular Formula | C8H14IN5 |
| Molecular Weight | 307.14 g/mol |
| Exact Mass | 307.03 |
| IUPAC Name | N'-(2-aminoethyl)-N'-(5-iodopyrimidin-2-yl)ethane-1,2-diamine |
| SMILES | NCCN(CCN)c1ncc(I)cn1 |
| InChI | InChI=1S/C8H14IN5/c9-7-5-12-8(13-6-7)14(3-1-10)4-2-11/h5-6H,1-4,10-11H2 |
| InChIKey | HNQNXVBEWNZZJU-UHFFFAOYSA-N |
| XLogP | -0.19 |
| TPSA | 81.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.14 |
| LogP ≤ 5 | -0.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|