C8H11F2IN4 — CID 107494092
N'-(2,2-difluoroethyl)-N'-(5-iodopyrimidin-2-yl)ethane-1,2-diamine (PubChem CID 107494092) has the molecular formula C8H11F2IN4 and a molecular weight of 328.10 g/mol. Its IUPAC name is N'-(2,2-difluoroethyl)-N'-(5-iodopyrimidin-2-yl)ethane-1,2-diamine.
| Compound Name | N'-(2,2-difluoroethyl)-N'-(5-iodopyrimidin-2-yl)ethane-1,2-diamine |
|---|---|
| PubChem CID | 107494092 |
| Molecular Formula | C8H11F2IN4 |
| Molecular Weight | 328.10 g/mol |
| Exact Mass | 328.00 |
| IUPAC Name | N'-(2,2-difluoroethyl)-N'-(5-iodopyrimidin-2-yl)ethane-1,2-diamine |
| SMILES | NCCN(CC(F)F)c1ncc(I)cn1 |
| InChI | InChI=1S/C8H11F2IN4/c9-7(10)5-15(2-1-12)8-13-3-6(11)4-14-8/h3-4,7H,1-2,5,12H2 |
| InChIKey | OCHMNFUFINFRPG-UHFFFAOYSA-N |
| XLogP | 1.11 |
| TPSA | 55.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.10 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|