About N'-(2,2-difluoroethyl)-N'-(2-methoxy-4-pyridinyl)ethane-1,2-diamine
N'-(2,2-difluoroethyl)-N'-(2-methoxy-4-pyridinyl)ethane-1,2-diamine (PubChem CID 107494035) has the molecular formula C10H15F2N3O
and a molecular weight of 231.25 g/mol. Its IUPAC name is N'-(2,2-difluoroethyl)-N'-(2-methoxy-4-pyridinyl)ethane-1,2-diamine.
Molecular Properties
| Compound Name | N'-(2,2-difluoroethyl)-N'-(2-methoxy-4-pyridinyl)ethane-1,2-diamine |
| PubChem CID | 107494035 |
| Molecular Formula | C10H15F2N3O |
| Molecular Weight | 231.25 g/mol |
| Exact Mass | 231.12 |
| IUPAC Name | N'-(2,2-difluoroethyl)-N'-(2-methoxy-4-pyridinyl)ethane-1,2-diamine |
| SMILES | COc1cc(N(CCN)CC(F)F)ccn1 |
| InChI | InChI=1S/C10H15F2N3O/c1-16-10-6-8(2-4-14-10)15(5-3-13)7-9(11)12/h2,4,6,9H,3,5,7,13H2,1H3 |
| InChIKey | IDSHFGJNPFLEPH-UHFFFAOYSA-N |
| XLogP | 1.12 |
| TPSA | 51.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 231.25 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N'-(2,2-difluoroethyl)-N'-(2-methoxy-4-pyridinyl)ethane-1,2-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N'-(2,2-difluoroethyl)-N'-(2-methoxy-4-pyridinyl)ethane-1,2-diamine?
The IUPAC name of N'-(2,2-difluoroethyl)-N'-(2-methoxy-4-pyridinyl)ethane-1,2-diamine (CID 107494035) is N'-(2,2-difluoroethyl)-N'-(2-methoxy-4-pyridinyl)ethane-1,2-diamine.
What is the SMILES notation for N'-(2,2-difluoroethyl)-N'-(2-methoxy-4-pyridinyl)ethane-1,2-diamine?
The canonical SMILES for N'-(2,2-difluoroethyl)-N'-(2-methoxy-4-pyridinyl)ethane-1,2-diamine is COc1cc(N(CCN)CC(F)F)ccn1.
What is the InChIKey of N'-(2,2-difluoroethyl)-N'-(2-methoxy-4-pyridinyl)ethane-1,2-diamine?
The InChIKey is IDSHFGJNPFLEPH-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H15F2N3O/c1-16-10-6-8(2-4-14-10)15(5-3-13)7-9(11)12/h2,4,6,9H,3,5,7,13H2,1H3.
What are the key properties of N'-(2,2-difluoroethyl)-N'-(2-methoxy-4-pyridinyl)ethane-1,2-diamine?
N'-(2,2-difluoroethyl)-N'-(2-methoxy-4-pyridinyl)ethane-1,2-diamine has a molecular weight of 231.25 g/mol, XLogP of 1.12, 6 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N'-(2,2-difluoroethyl)-N'-(2-methoxy-4-pyridinyl)ethane-1,2-diamine is sourced from PubChem (CID 107494035), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).