C15H22O — CID 11665700
(1S,4R,5S,7S,10R,11S)-5,10,11-trimethyltetracyclo[5.3.1.11,4.05,11]dodecan-8-one (PubChem CID 11665700) has the molecular formula C15H22O and a molecular weight of 218.34 g/mol. Its IUPAC name is (1S,4R,5S,7S,10R,11S)-5,10,11-trimethyltetracyclo[5.3.1.11,4.05,11]dodecan-8-one.
| Compound Name | (1S,4R,5S,7S,10R,11S)-5,10,11-trimethyltetracyclo[5.3.1.11,4.05,11]dodecan-8-one |
|---|---|
| PubChem CID | 11665700 |
| Molecular Formula | C15H22O |
| Molecular Weight | 218.34 g/mol |
| Exact Mass | 218.17 |
| IUPAC Name | (1S,4R,5S,7S,10R,11S)-5,10,11-trimethyltetracyclo[5.3.1.11,4.05,11]dodecan-8-one |
| SMILES | C[C@@H]1CC(=O)[C@H]2C[C@@]3(C)[C@@H]4CC[C@@]1(C4)[C@@]23C |
| InChI | InChI=1S/C15H22O/c1-9-6-12(16)11-8-13(2)10-4-5-15(9,7-10)14(11,13)3/h9-11H,4-8H2,1-3H3/t9-,10-,11-,13+,14+,15+/m1/s1 |
| InChIKey | BUQAGRKDLWAMSQ-OUMODKTKSA-N |
| XLogP | 3.43 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.34 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |