C8H12N4O2 — CID 116658027
1-cyclobutyl-3-(5-methyl-1,3,4-oxadiazol-2-yl)urea (PubChem CID 116658027) has the molecular formula C8H12N4O2 and a molecular weight of 196.21 g/mol. Its IUPAC name is 1-cyclobutyl-3-(5-methyl-1,3,4-oxadiazol-2-yl)urea.
| Compound Name | 1-cyclobutyl-3-(5-methyl-1,3,4-oxadiazol-2-yl)urea |
|---|---|
| PubChem CID | 116658027 |
| Molecular Formula | C8H12N4O2 |
| Molecular Weight | 196.21 g/mol |
| Exact Mass | 196.10 |
| IUPAC Name | 1-cyclobutyl-3-(5-methyl-1,3,4-oxadiazol-2-yl)urea |
| SMILES | Cc1nnc(NC(=O)NC2CCC2)o1 |
| InChI | InChI=1S/C8H12N4O2/c1-5-11-12-8(14-5)10-7(13)9-6-3-2-4-6/h6H,2-4H2,1H3,(H2,9,10,12,13) |
| InChIKey | CVMVPGWLVAGKGR-UHFFFAOYSA-N |
| XLogP | 1.05 |
| TPSA | 80.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.21 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |