C9H13N3O2 — CID 115672499
1-cyclobutyl-3-(4-methyl-1,3-oxazol-2-yl)urea (PubChem CID 115672499) has the molecular formula C9H13N3O2 and a molecular weight of 195.22 g/mol. Its IUPAC name is 1-cyclobutyl-3-(4-methyl-1,3-oxazol-2-yl)urea.
| Compound Name | 1-cyclobutyl-3-(4-methyl-1,3-oxazol-2-yl)urea |
|---|---|
| PubChem CID | 115672499 |
| Molecular Formula | C9H13N3O2 |
| Molecular Weight | 195.22 g/mol |
| Exact Mass | 195.10 |
| IUPAC Name | 1-cyclobutyl-3-(4-methyl-1,3-oxazol-2-yl)urea |
| SMILES | Cc1coc(NC(=O)NC2CCC2)n1 |
| InChI | InChI=1S/C9H13N3O2/c1-6-5-14-9(10-6)12-8(13)11-7-3-2-4-7/h5,7H,2-4H2,1H3,(H2,10,11,12,13) |
| InChIKey | XBIDJURKFCHYLR-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 67.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.22 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |