C7H8F3N3O2 — CID 116658005
1-(4-methyl-1,3-oxazol-2-yl)-3-(2,2,2-trifluoroethyl)urea (PubChem CID 116658005) has the molecular formula C7H8F3N3O2 and a molecular weight of 223.15 g/mol. Its IUPAC name is 1-(4-methyl-1,3-oxazol-2-yl)-3-(2,2,2-trifluoroethyl)urea.
| Compound Name | 1-(4-methyl-1,3-oxazol-2-yl)-3-(2,2,2-trifluoroethyl)urea |
|---|---|
| PubChem CID | 116658005 |
| Molecular Formula | C7H8F3N3O2 |
| Molecular Weight | 223.15 g/mol |
| Exact Mass | 223.06 |
| IUPAC Name | 1-(4-methyl-1,3-oxazol-2-yl)-3-(2,2,2-trifluoroethyl)urea |
| SMILES | Cc1coc(NC(=O)NCC(F)(F)F)n1 |
| InChI | InChI=1S/C7H8F3N3O2/c1-4-2-15-6(12-4)13-5(14)11-3-7(8,9)10/h2H,3H2,1H3,(H2,11,12,13,14) |
| InChIKey | WAXDFIRHLFQQKI-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 67.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.15 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |