C12H11F3N2O2 — CID 122133068
1-(3-methyl-1-benzofuran-5-yl)-3-(2,2,2-trifluoroethyl)urea (PubChem CID 122133068) has the molecular formula C12H11F3N2O2 and a molecular weight of 272.23 g/mol. Its IUPAC name is 1-(3-methyl-1-benzofuran-5-yl)-3-(2,2,2-trifluoroethyl)urea.
| Compound Name | 1-(3-methyl-1-benzofuran-5-yl)-3-(2,2,2-trifluoroethyl)urea |
|---|---|
| PubChem CID | 122133068 |
| Molecular Formula | C12H11F3N2O2 |
| Molecular Weight | 272.23 g/mol |
| Exact Mass | 272.08 |
| IUPAC Name | 1-(3-methyl-1-benzofuran-5-yl)-3-(2,2,2-trifluoroethyl)urea |
| SMILES | Cc1coc2ccc(NC(=O)NCC(F)(F)F)cc12 |
| InChI | InChI=1S/C12H11F3N2O2/c1-7-5-19-10-3-2-8(4-9(7)10)17-11(18)16-6-12(13,14)15/h2-5H,6H2,1H3,(H2,16,17,18) |
| InChIKey | UQPVUTJCWRNFHP-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 54.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.23 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |