C7H12N4O — CID 116659041
5-amino-4-cyclobutyl-2-methyl-1,2,4-triazol-3-one (PubChem CID 116659041) has the molecular formula C7H12N4O and a molecular weight of 168.20 g/mol. Its IUPAC name is 5-amino-4-cyclobutyl-2-methyl-1,2,4-triazol-3-one.
| Compound Name | 5-amino-4-cyclobutyl-2-methyl-1,2,4-triazol-3-one |
|---|---|
| PubChem CID | 116659041 |
| Molecular Formula | C7H12N4O |
| Molecular Weight | 168.20 g/mol |
| Exact Mass | 168.10 |
| IUPAC Name | 5-amino-4-cyclobutyl-2-methyl-1,2,4-triazol-3-one |
| SMILES | Cn1nc(N)n(C2CCC2)c1=O |
| InChI | InChI=1S/C7H12N4O/c1-10-7(12)11(6(8)9-10)5-3-2-4-5/h5H,2-4H2,1H3,(H2,8,9) |
| InChIKey | BQDDWSUYINRBBG-UHFFFAOYSA-N |
| XLogP | -0.11 |
| TPSA | 65.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 168.20 |
| LogP ≤ 5 | -0.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |