C7H10ClN3O — CID 116659040
5-chloro-4-cyclobutyl-2-methyl-1,2,4-triazol-3-one (PubChem CID 116659040) has the molecular formula C7H10ClN3O and a molecular weight of 187.63 g/mol. Its IUPAC name is 5-chloro-4-cyclobutyl-2-methyl-1,2,4-triazol-3-one.
| Compound Name | 5-chloro-4-cyclobutyl-2-methyl-1,2,4-triazol-3-one |
|---|---|
| PubChem CID | 116659040 |
| Molecular Formula | C7H10ClN3O |
| Molecular Weight | 187.63 g/mol |
| Exact Mass | 187.05 |
| IUPAC Name | 5-chloro-4-cyclobutyl-2-methyl-1,2,4-triazol-3-one |
| SMILES | Cn1nc(Cl)n(C2CCC2)c1=O |
| InChI | InChI=1S/C7H10ClN3O/c1-10-7(12)11(6(8)9-10)5-3-2-4-5/h5H,2-4H2,1H3 |
| InChIKey | OOAKSMGSWRRJOB-UHFFFAOYSA-N |
| XLogP | 0.96 |
| TPSA | 39.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 187.63 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |