C12H18O5 — CID 11665906
(3aS,6aR)-3a-[(1S)-1-(methoxymethoxy)ethyl]-2,2-dimethyl-6aH-cyclopenta[d][1,3]dioxol-6-one (PubChem CID 11665906) has the molecular formula C12H18O5 and a molecular weight of 242.27 g/mol. Its IUPAC name is (3aS,6aR)-3a-[(1S)-1-(methoxymethoxy)ethyl]-2,2-dimethyl-6aH-cyclopenta[d][1,3]dioxol-6-one.
| Compound Name | (3aS,6aR)-3a-[(1S)-1-(methoxymethoxy)ethyl]-2,2-dimethyl-6aH-cyclopenta[d][1,3]dioxol-6-one |
|---|---|
| PubChem CID | 11665906 |
| Molecular Formula | C12H18O5 |
| Molecular Weight | 242.27 g/mol |
| Exact Mass | 242.12 |
| IUPAC Name | (3aS,6aR)-3a-[(1S)-1-(methoxymethoxy)ethyl]-2,2-dimethyl-6aH-cyclopenta[d][1,3]dioxol-6-one |
| SMILES | COCO[C@@H](C)[C@@]12C=CC(=O)[C@@H]1OC(C)(C)O2 |
| InChI | InChI=1S/C12H18O5/c1-8(15-7-14-4)12-6-5-9(13)10(12)16-11(2,3)17-12/h5-6,8,10H,7H2,1-4H3/t8-,10-,12-/m0/s1 |
| InChIKey | RSVBFJOYUIKOJL-PEXQALLHSA-N |
| XLogP | 1.02 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.27 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|