C12H16O5 — CID 56935436
1-[(3'aR,5S,5'S,6'aR)-2',2'-dimethylspiro[2H-furan-5,6'-5,6a-dihydro-3aH-furo[2,3-d][1,3]dioxole]-5'-yl]ethanone (PubChem CID 56935436) has the molecular formula C12H16O5 and a molecular weight of 240.25 g/mol. Its IUPAC name is 1-[(3'aR,5S,5'S,6'aR)-2',2'-dimethylspiro[2H-furan-5,6'-5,6a-dihydro-3aH-furo[2,3-d][1,3]dioxole]-5'-yl]ethanone.
| Compound Name | 1-[(3'aR,5S,5'S,6'aR)-2',2'-dimethylspiro[2H-furan-5,6'-5,6a-dihydro-3aH-furo[2,3-d][1,3]dioxole]-5'-yl]ethanone |
|---|---|
| PubChem CID | 56935436 |
| Molecular Formula | C12H16O5 |
| Molecular Weight | 240.25 g/mol |
| Exact Mass | 240.10 |
| IUPAC Name | 1-[(3'aR,5S,5'S,6'aR)-2',2'-dimethylspiro[2H-furan-5,6'-5,6a-dihydro-3aH-furo[2,3-d][1,3]dioxole]-5'-yl]ethanone |
| SMILES | CC(=O)[C@H]1O[C@@H]2OC(C)(C)O[C@@H]2[C@@]12C=CCO2 |
| InChI | InChI=1S/C12H16O5/c1-7(13)8-12(5-4-6-14-12)9-10(15-8)17-11(2,3)16-9/h4-5,8-10H,6H2,1-3H3/t8-,9+,10-,12-/m1/s1 |
| InChIKey | XFEFLVZXYGUWPU-DTHBNOIPSA-N |
| XLogP | 0.78 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.25 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|