C19H24O — CID 116659683
1-(cyclohexen-1-yl)-3-(1,2,3,4-tetrahydronaphthalen-1-yl)propan-2-one (PubChem CID 116659683) has the molecular formula C19H24O and a molecular weight of 268.40 g/mol. Its IUPAC name is 1-(cyclohexen-1-yl)-3-(1,2,3,4-tetrahydronaphthalen-1-yl)propan-2-one.
| Compound Name | 1-(cyclohexen-1-yl)-3-(1,2,3,4-tetrahydronaphthalen-1-yl)propan-2-one |
|---|---|
| PubChem CID | 116659683 |
| Molecular Formula | C19H24O |
| Molecular Weight | 268.40 g/mol |
| Exact Mass | 268.18 |
| IUPAC Name | 1-(cyclohexen-1-yl)-3-(1,2,3,4-tetrahydronaphthalen-1-yl)propan-2-one |
| SMILES | O=C(CC1=CCCCC1)CC1CCCc2ccccc21 |
| InChI | InChI=1S/C19H24O/c20-18(13-15-7-2-1-3-8-15)14-17-11-6-10-16-9-4-5-12-19(16)17/h4-5,7,9,12,17H,1-3,6,8,10-11,13-14H2 |
| InChIKey | MOVAGCZDGQPNAA-UHFFFAOYSA-N |
| XLogP | 4.96 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.40 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|