C18H27N — CID 116661135
1-(cyclohexen-1-yl)-3-(2,4,6-trimethylphenyl)propan-2-amine (PubChem CID 116661135) has the molecular formula C18H27N and a molecular weight of 257.42 g/mol. Its IUPAC name is 1-(cyclohexen-1-yl)-3-(2,4,6-trimethylphenyl)propan-2-amine.
| Compound Name | 1-(cyclohexen-1-yl)-3-(2,4,6-trimethylphenyl)propan-2-amine |
|---|---|
| PubChem CID | 116661135 |
| Molecular Formula | C18H27N |
| Molecular Weight | 257.42 g/mol |
| Exact Mass | 257.21 |
| IUPAC Name | 1-(cyclohexen-1-yl)-3-(2,4,6-trimethylphenyl)propan-2-amine |
| SMILES | Cc1cc(C)c(CC(N)CC2=CCCCC2)c(C)c1 |
| InChI | InChI=1S/C18H27N/c1-13-9-14(2)18(15(3)10-13)12-17(19)11-16-7-5-4-6-8-16/h7,9-10,17H,4-6,8,11-12,19H2,1-3H3 |
| InChIKey | XXJNRGJJNHGBDO-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.42 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|