C15H19F2N — CID 105406982
1-(cyclohexen-1-yl)-3-(3,5-difluorophenyl)propan-2-amine (PubChem CID 105406982) has the molecular formula C15H19F2N and a molecular weight of 251.32 g/mol. Its IUPAC name is 1-(cyclohexen-1-yl)-3-(3,5-difluorophenyl)propan-2-amine.
| Compound Name | 1-(cyclohexen-1-yl)-3-(3,5-difluorophenyl)propan-2-amine |
|---|---|
| PubChem CID | 105406982 |
| Molecular Formula | C15H19F2N |
| Molecular Weight | 251.32 g/mol |
| Exact Mass | 251.15 |
| IUPAC Name | 1-(cyclohexen-1-yl)-3-(3,5-difluorophenyl)propan-2-amine |
| SMILES | NC(CC1=CCCCC1)Cc1cc(F)cc(F)c1 |
| InChI | InChI=1S/C15H19F2N/c16-13-6-12(7-14(17)10-13)9-15(18)8-11-4-2-1-3-5-11/h4,6-7,10,15H,1-3,5,8-9,18H2 |
| InChIKey | AHDQUYFPNOKESZ-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.32 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|