C13H23N5O2S — CID 116671563
4-amino-N-methyl-N-[3-(methylamino)propyl]-2-morpholin-4-yl-1,3-thiazole-5-carboxamide (PubChem CID 116671563) has the molecular formula C13H23N5O2S and a molecular weight of 313.43 g/mol. Its IUPAC name is 4-amino-N-methyl-N-[3-(methylamino)propyl]-2-morpholin-4-yl-1,3-thiazole-5-carboxamide.
| Compound Name | 4-amino-N-methyl-N-[3-(methylamino)propyl]-2-morpholin-4-yl-1,3-thiazole-5-carboxamide |
|---|---|
| PubChem CID | 116671563 |
| Molecular Formula | C13H23N5O2S |
| Molecular Weight | 313.43 g/mol |
| Exact Mass | 313.16 |
| IUPAC Name | 4-amino-N-methyl-N-[3-(methylamino)propyl]-2-morpholin-4-yl-1,3-thiazole-5-carboxamide |
| SMILES | CNCCCN(C)C(=O)c1sc(N2CCOCC2)nc1N |
| InChI | InChI=1S/C13H23N5O2S/c1-15-4-3-5-17(2)12(19)10-11(14)16-13(21-10)18-6-8-20-9-7-18/h15H,3-9,14H2,1-2H3 |
| InChIKey | BRKLJOZPNNMJNQ-UHFFFAOYSA-N |
| XLogP | 0.24 |
| TPSA | 83.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.43 |
| LogP ≤ 5 | 0.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|