C14H16N4O3 — CID 116677173
5-[2-(azetidin-3-ylidene)propanoylamino]benzene-1,3-dicarboxamide (PubChem CID 116677173) has the molecular formula C14H16N4O3 and a molecular weight of 288.31 g/mol. Its IUPAC name is 5-[2-(azetidin-3-ylidene)propanoylamino]benzene-1,3-dicarboxamide.
| Compound Name | 5-[2-(azetidin-3-ylidene)propanoylamino]benzene-1,3-dicarboxamide |
|---|---|
| PubChem CID | 116677173 |
| Molecular Formula | C14H16N4O3 |
| Molecular Weight | 288.31 g/mol |
| Exact Mass | 288.12 |
| IUPAC Name | 5-[2-(azetidin-3-ylidene)propanoylamino]benzene-1,3-dicarboxamide |
| SMILES | CC(C(=O)Nc1cc(C(N)=O)cc(C(N)=O)c1)=C1CNC1 |
| InChI | InChI=1S/C14H16N4O3/c1-7(10-5-17-6-10)14(21)18-11-3-8(12(15)19)2-9(4-11)13(16)20/h2-4,17H,5-6H2,1H3,(H2,15,19)(H2,16,20)(H,18,21) |
| InChIKey | AMLZXFWAHLSGPS-UHFFFAOYSA-N |
| XLogP | -0.26 |
| TPSA | 127.31 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.31 |
| LogP ≤ 5 | -0.26 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|