C13H12Cl2N2O3 — CID 116678751
4-[2-(azetidin-3-ylidene)propanoylamino]-3,5-dichlorobenzoic acid (PubChem CID 116678751) has the molecular formula C13H12Cl2N2O3 and a molecular weight of 315.16 g/mol. Its IUPAC name is 4-[2-(azetidin-3-ylidene)propanoylamino]-3,5-dichlorobenzoic acid.
| Compound Name | 4-[2-(azetidin-3-ylidene)propanoylamino]-3,5-dichlorobenzoic acid |
|---|---|
| PubChem CID | 116678751 |
| Molecular Formula | C13H12Cl2N2O3 |
| Molecular Weight | 315.16 g/mol |
| Exact Mass | 314.02 |
| IUPAC Name | 4-[2-(azetidin-3-ylidene)propanoylamino]-3,5-dichlorobenzoic acid |
| SMILES | CC(C(=O)Nc1c(Cl)cc(C(=O)O)cc1Cl)=C1CNC1 |
| InChI | InChI=1S/C13H12Cl2N2O3/c1-6(8-4-16-5-8)12(18)17-11-9(14)2-7(13(19)20)3-10(11)15/h2-3,16H,4-5H2,1H3,(H,17,18)(H,19,20) |
| InChIKey | WRPDIHDWKJYSNA-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.16 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|