C14H24N2O4S — CID 116685366
tert-butyl 2-[cyano(methylsulfonyl)methyl]-4-methylpiperidine-1-carboxylate (PubChem CID 116685366) has the molecular formula C14H24N2O4S and a molecular weight of 316.42 g/mol. Its IUPAC name is tert-butyl 2-[cyano(methylsulfonyl)methyl]-4-methylpiperidine-1-carboxylate.
| Compound Name | tert-butyl 2-[cyano(methylsulfonyl)methyl]-4-methylpiperidine-1-carboxylate |
|---|---|
| PubChem CID | 116685366 |
| Molecular Formula | C14H24N2O4S |
| Molecular Weight | 316.42 g/mol |
| Exact Mass | 316.15 |
| IUPAC Name | tert-butyl 2-[cyano(methylsulfonyl)methyl]-4-methylpiperidine-1-carboxylate |
| SMILES | CC1CCN(C(=O)OC(C)(C)C)C(C(C#N)S(C)(=O)=O)C1 |
| InChI | InChI=1S/C14H24N2O4S/c1-10-6-7-16(13(17)20-14(2,3)4)11(8-10)12(9-15)21(5,18)19/h10-12H,6-8H2,1-5H3 |
| InChIKey | IQOVNPOEVRCDDD-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 87.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.42 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |