C24H28N4O2 — CID 11668562
2-[4-[2-(hydroxymethyl)-4-methylanilino]piperidin-1-yl]-N-quinolin-6-ylacetamide (PubChem CID 11668562) has the molecular formula C24H28N4O2 and a molecular weight of 404.51 g/mol. Its IUPAC name is 2-[4-[2-(hydroxymethyl)-4-methylanilino]piperidin-1-yl]-N-quinolin-6-ylacetamide.
| Compound Name | 2-[4-[2-(hydroxymethyl)-4-methylanilino]piperidin-1-yl]-N-quinolin-6-ylacetamide |
|---|---|
| PubChem CID | 11668562 |
| Molecular Formula | C24H28N4O2 |
| Molecular Weight | 404.51 g/mol |
| Exact Mass | 404.22 |
| IUPAC Name | 2-[4-[2-(hydroxymethyl)-4-methylanilino]piperidin-1-yl]-N-quinolin-6-ylacetamide |
| SMILES | Cc1ccc(NC2CCN(CC(=O)Nc3ccc4ncccc4c3)CC2)c(CO)c1 |
| InChI | InChI=1S/C24H28N4O2/c1-17-4-6-23(19(13-17)16-29)26-20-8-11-28(12-9-20)15-24(30)27-21-5-7-22-18(14-21)3-2-10-25-22/h2-7,10,13-14,20,26,29H,8-9,11-12,15-16H2,1H3,(H,27,30) |
| InChIKey | WZTDRMMGQUNBHH-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 77.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.51 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |