C23H25FN4O2 — CID 11682940
2-[4-[4-fluoro-2-(hydroxymethyl)anilino]piperidin-1-yl]-N-quinolin-3-ylacetamide (PubChem CID 11682940) has the molecular formula C23H25FN4O2 and a molecular weight of 408.48 g/mol. Its IUPAC name is 2-[4-[4-fluoro-2-(hydroxymethyl)anilino]piperidin-1-yl]-N-quinolin-3-ylacetamide.
| Compound Name | 2-[4-[4-fluoro-2-(hydroxymethyl)anilino]piperidin-1-yl]-N-quinolin-3-ylacetamide |
|---|---|
| PubChem CID | 11682940 |
| Molecular Formula | C23H25FN4O2 |
| Molecular Weight | 408.48 g/mol |
| Exact Mass | 408.20 |
| IUPAC Name | 2-[4-[4-fluoro-2-(hydroxymethyl)anilino]piperidin-1-yl]-N-quinolin-3-ylacetamide |
| SMILES | O=C(CN1CCC(Nc2ccc(F)cc2CO)CC1)Nc1cnc2ccccc2c1 |
| InChI | InChI=1S/C23H25FN4O2/c24-18-5-6-22(17(11-18)15-29)26-19-7-9-28(10-8-19)14-23(30)27-20-12-16-3-1-2-4-21(16)25-13-20/h1-6,11-13,19,26,29H,7-10,14-15H2,(H,27,30) |
| InChIKey | FWRCYGIZSRKKON-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 77.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.48 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |