C13H23N3 — CID 116686145
2-[2-(1,3-dimethylpyrazol-4-yl)ethyl]-4-methylpiperidine (PubChem CID 116686145) has the molecular formula C13H23N3 and a molecular weight of 221.35 g/mol. Its IUPAC name is 2-[2-(1,3-dimethylpyrazol-4-yl)ethyl]-4-methylpiperidine.
| Compound Name | 2-[2-(1,3-dimethylpyrazol-4-yl)ethyl]-4-methylpiperidine |
|---|---|
| PubChem CID | 116686145 |
| Molecular Formula | C13H23N3 |
| Molecular Weight | 221.35 g/mol |
| Exact Mass | 221.19 |
| IUPAC Name | 2-[2-(1,3-dimethylpyrazol-4-yl)ethyl]-4-methylpiperidine |
| SMILES | Cc1nn(C)cc1CCC1CC(C)CCN1 |
| InChI | InChI=1S/C13H23N3/c1-10-6-7-14-13(8-10)5-4-12-9-16(3)15-11(12)2/h9-10,13-14H,4-8H2,1-3H3 |
| InChIKey | PQLQHNIJMMMDTN-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 29.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.35 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |