C11H19N3 — CID 130682300
2-(1,3-dimethylpyrazol-4-yl)-4-methylpiperidine (PubChem CID 130682300) has the molecular formula C11H19N3 and a molecular weight of 193.29 g/mol. Its IUPAC name is 2-(1,3-dimethylpyrazol-4-yl)-4-methylpiperidine.
| Compound Name | 2-(1,3-dimethylpyrazol-4-yl)-4-methylpiperidine |
|---|---|
| PubChem CID | 130682300 |
| Molecular Formula | C11H19N3 |
| Molecular Weight | 193.29 g/mol |
| Exact Mass | 193.16 |
| IUPAC Name | 2-(1,3-dimethylpyrazol-4-yl)-4-methylpiperidine |
| SMILES | Cc1nn(C)cc1C1CC(C)CCN1 |
| InChI | InChI=1S/C11H19N3/c1-8-4-5-12-11(6-8)10-7-14(3)13-9(10)2/h7-8,11-12H,4-6H2,1-3H3 |
| InChIKey | RUPBXWXFNXNRIN-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 29.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.29 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |