C10H16N2S — CID 164650987
4-methyl-5-(4-methylpiperidin-2-yl)-1,3-thiazole (PubChem CID 164650987) has the molecular formula C10H16N2S and a molecular weight of 196.32 g/mol. Its IUPAC name is 4-methyl-5-(4-methylpiperidin-2-yl)-1,3-thiazole.
| Compound Name | 4-methyl-5-(4-methylpiperidin-2-yl)-1,3-thiazole |
|---|---|
| PubChem CID | 164650987 |
| Molecular Formula | C10H16N2S |
| Molecular Weight | 196.32 g/mol |
| Exact Mass | 196.10 |
| IUPAC Name | 4-methyl-5-(4-methylpiperidin-2-yl)-1,3-thiazole |
| SMILES | Cc1ncsc1C1CC(C)CCN1 |
| InChI | InChI=1S/C10H16N2S/c1-7-3-4-11-9(5-7)10-8(2)12-6-13-10/h6-7,9,11H,3-5H2,1-2H3 |
| InChIKey | ZQWFHWHYUMTRMX-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.32 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |