C13H19NS — CID 176552899
4-methyl-5-(4-prop-1-en-2-ylcyclohexyl)-1,3-thiazole (PubChem CID 176552899) has the molecular formula C13H19NS and a molecular weight of 221.37 g/mol. Its IUPAC name is 4-methyl-5-(4-prop-1-en-2-ylcyclohexyl)-1,3-thiazole.
| Compound Name | 4-methyl-5-(4-prop-1-en-2-ylcyclohexyl)-1,3-thiazole |
|---|---|
| PubChem CID | 176552899 |
| Molecular Formula | C13H19NS |
| Molecular Weight | 221.37 g/mol |
| Exact Mass | 221.12 |
| IUPAC Name | 4-methyl-5-(4-prop-1-en-2-ylcyclohexyl)-1,3-thiazole |
| SMILES | C=C(C)C1CCC(c2scnc2C)CC1 |
| InChI | InChI=1S/C13H19NS/c1-9(2)11-4-6-12(7-5-11)13-10(3)14-8-15-13/h8,11-12H,1,4-7H2,2-3H3 |
| InChIKey | MJPSPFZMVMMWMG-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.37 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|