C10H15ClN2 — CID 130642452
4-(2-chlorocyclopentyl)-1,3-dimethylpyrazole (PubChem CID 130642452) has the molecular formula C10H15ClN2 and a molecular weight of 198.70 g/mol. Its IUPAC name is 4-(2-chlorocyclopentyl)-1,3-dimethylpyrazole.
| Compound Name | 4-(2-chlorocyclopentyl)-1,3-dimethylpyrazole |
|---|---|
| PubChem CID | 130642452 |
| Molecular Formula | C10H15ClN2 |
| Molecular Weight | 198.70 g/mol |
| Exact Mass | 198.09 |
| IUPAC Name | 4-(2-chlorocyclopentyl)-1,3-dimethylpyrazole |
| SMILES | Cc1nn(C)cc1C1CCCC1Cl |
| InChI | InChI=1S/C10H15ClN2/c1-7-9(6-13(2)12-7)8-4-3-5-10(8)11/h6,8,10H,3-5H2,1-2H3 |
| InChIKey | IYEGBEHZUJTWNM-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.70 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|