C14H18Cl2FN — CID 116686192
2-[2-(2,4-dichloro-5-fluorophenyl)ethyl]-4-methylpiperidine (PubChem CID 116686192) has the molecular formula C14H18Cl2FN and a molecular weight of 290.21 g/mol. Its IUPAC name is 2-[2-(2,4-dichloro-5-fluorophenyl)ethyl]-4-methylpiperidine.
| Compound Name | 2-[2-(2,4-dichloro-5-fluorophenyl)ethyl]-4-methylpiperidine |
|---|---|
| PubChem CID | 116686192 |
| Molecular Formula | C14H18Cl2FN |
| Molecular Weight | 290.21 g/mol |
| Exact Mass | 289.08 |
| IUPAC Name | 2-[2-(2,4-dichloro-5-fluorophenyl)ethyl]-4-methylpiperidine |
| SMILES | CC1CCNC(CCc2cc(F)c(Cl)cc2Cl)C1 |
| InChI | InChI=1S/C14H18Cl2FN/c1-9-4-5-18-11(6-9)3-2-10-7-14(17)13(16)8-12(10)15/h7-9,11,18H,2-6H2,1H3 |
| InChIKey | XFVKLEOLTUTDQR-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.21 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|