C25H32N2O3 — CID 11668666
(3S)-N-(4-hydroxycyclohexyl)-1-(3-phenylmethoxyphenyl)piperidine-3-carboxamide (PubChem CID 11668666) has the molecular formula C25H32N2O3 and a molecular weight of 408.54 g/mol. Its IUPAC name is (3S)-N-(4-hydroxycyclohexyl)-1-(3-phenylmethoxyphenyl)piperidine-3-carboxamide.
| Compound Name | (3S)-N-(4-hydroxycyclohexyl)-1-(3-phenylmethoxyphenyl)piperidine-3-carboxamide |
|---|---|
| PubChem CID | 11668666 |
| Molecular Formula | C25H32N2O3 |
| Molecular Weight | 408.54 g/mol |
| Exact Mass | 408.24 |
| IUPAC Name | (3S)-N-(4-hydroxycyclohexyl)-1-(3-phenylmethoxyphenyl)piperidine-3-carboxamide |
| SMILES | O=C(NC1CCC(O)CC1)[C@H]1CCCN(c2cccc(OCc3ccccc3)c2)C1 |
| InChI | InChI=1S/C25H32N2O3/c28-23-13-11-21(12-14-23)26-25(29)20-8-5-15-27(17-20)22-9-4-10-24(16-22)30-18-19-6-2-1-3-7-19/h1-4,6-7,9-10,16,20-21,23,28H,5,8,11-15,17-18H2,(H,26,29)/t20-,21?,23?/m0/s1 |
| InChIKey | NODJDBZYKIIBAU-ZJOBEGKPSA-N |
| XLogP | 3.90 |
| TPSA | 61.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.54 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |