C16H24ClNO2S — CID 116687766
tert-butyl 2-[3-chloro-2-[(propan-2-ylamino)methyl]phenyl]sulfanylacetate (PubChem CID 116687766) has the molecular formula C16H24ClNO2S and a molecular weight of 329.89 g/mol. Its IUPAC name is tert-butyl 2-[3-chloro-2-[(propan-2-ylamino)methyl]phenyl]sulfanylacetate.
| Compound Name | tert-butyl 2-[3-chloro-2-[(propan-2-ylamino)methyl]phenyl]sulfanylacetate |
|---|---|
| PubChem CID | 116687766 |
| Molecular Formula | C16H24ClNO2S |
| Molecular Weight | 329.89 g/mol |
| Exact Mass | 329.12 |
| IUPAC Name | tert-butyl 2-[3-chloro-2-[(propan-2-ylamino)methyl]phenyl]sulfanylacetate |
| SMILES | CC(C)NCc1c(Cl)cccc1SCC(=O)OC(C)(C)C |
| InChI | InChI=1S/C16H24ClNO2S/c1-11(2)18-9-12-13(17)7-6-8-14(12)21-10-15(19)20-16(3,4)5/h6-8,11,18H,9-10H2,1-5H3 |
| InChIKey | LAIWGNFSTYMKBP-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.89 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |