C14H23N3O2S — CID 116687827
tert-butyl 2-[5-[(propan-2-ylamino)methyl]pyrimidin-2-yl]sulfanylacetate (PubChem CID 116687827) has the molecular formula C14H23N3O2S and a molecular weight of 297.42 g/mol. Its IUPAC name is tert-butyl 2-[5-[(propan-2-ylamino)methyl]pyrimidin-2-yl]sulfanylacetate.
| Compound Name | tert-butyl 2-[5-[(propan-2-ylamino)methyl]pyrimidin-2-yl]sulfanylacetate |
|---|---|
| PubChem CID | 116687827 |
| Molecular Formula | C14H23N3O2S |
| Molecular Weight | 297.42 g/mol |
| Exact Mass | 297.15 |
| IUPAC Name | tert-butyl 2-[5-[(propan-2-ylamino)methyl]pyrimidin-2-yl]sulfanylacetate |
| SMILES | CC(C)NCc1cnc(SCC(=O)OC(C)(C)C)nc1 |
| InChI | InChI=1S/C14H23N3O2S/c1-10(2)15-6-11-7-16-13(17-8-11)20-9-12(18)19-14(3,4)5/h7-8,10,15H,6,9H2,1-5H3 |
| InChIKey | WNUBVVPHDONOCY-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 64.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.42 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |