C15H25NO3S — CID 116688056
tert-butyl 2-[[5-[(propan-2-ylamino)methyl]furan-2-yl]methylsulfanyl]acetate (PubChem CID 116688056) has the molecular formula C15H25NO3S and a molecular weight of 299.44 g/mol. Its IUPAC name is tert-butyl 2-[[5-[(propan-2-ylamino)methyl]furan-2-yl]methylsulfanyl]acetate.
| Compound Name | tert-butyl 2-[[5-[(propan-2-ylamino)methyl]furan-2-yl]methylsulfanyl]acetate |
|---|---|
| PubChem CID | 116688056 |
| Molecular Formula | C15H25NO3S |
| Molecular Weight | 299.44 g/mol |
| Exact Mass | 299.16 |
| IUPAC Name | tert-butyl 2-[[5-[(propan-2-ylamino)methyl]furan-2-yl]methylsulfanyl]acetate |
| SMILES | CC(C)NCc1ccc(CSCC(=O)OC(C)(C)C)o1 |
| InChI | InChI=1S/C15H25NO3S/c1-11(2)16-8-12-6-7-13(18-12)9-20-10-14(17)19-15(3,4)5/h6-7,11,16H,8-10H2,1-5H3 |
| InChIKey | NFMBVZJVAUIUNS-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 51.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.44 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |