C23H20O8 — CID 11669026
dimethyl 2,2-dimethoxy-10'-oxospiro[furan-5,9'-phenanthrene]-3,4-dicarboxylate (PubChem CID 11669026) has the molecular formula C23H20O8 and a molecular weight of 424.41 g/mol. Its IUPAC name is dimethyl 2,2-dimethoxy-10'-oxospiro[furan-5,9'-phenanthrene]-3,4-dicarboxylate.
| Compound Name | dimethyl 2,2-dimethoxy-10'-oxospiro[furan-5,9'-phenanthrene]-3,4-dicarboxylate |
|---|---|
| PubChem CID | 11669026 |
| Molecular Formula | C23H20O8 |
| Molecular Weight | 424.41 g/mol |
| Exact Mass | 424.12 |
| IUPAC Name | dimethyl 2,2-dimethoxy-10'-oxospiro[furan-5,9'-phenanthrene]-3,4-dicarboxylate |
| SMILES | COC(=O)C1=C(C(=O)OC)C2(OC1(OC)OC)C(=O)c1ccccc1-c1ccccc12 |
| InChI | InChI=1S/C23H20O8/c1-27-20(25)17-18(21(26)28-2)23(29-3,30-4)31-22(17)16-12-8-7-10-14(16)13-9-5-6-11-15(13)19(22)24/h5-12H,1-4H3 |
| InChIKey | XNISBTCYZDVJHS-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 97.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.41 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|