C22H20N6O2S — CID 11669192
5-methyl-3-[4-[3-methyl-8-(4-methylphenyl)-7,8-dihydro-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazepin-6-yl]phenyl]-1,3,4-oxadiazol-2-one (PubChem CID 11669192) has the molecular formula C22H20N6O2S and a molecular weight of 432.51 g/mol. Its IUPAC name is 5-methyl-3-[4-[3-methyl-8-(4-methylphenyl)-7,8-dihydro-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazepin-6-yl]phenyl]-1,3,4-oxadiazol-2-one.
| Compound Name | 5-methyl-3-[4-[3-methyl-8-(4-methylphenyl)-7,8-dihydro-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazepin-6-yl]phenyl]-1,3,4-oxadiazol-2-one |
|---|---|
| PubChem CID | 11669192 |
| Molecular Formula | C22H20N6O2S |
| Molecular Weight | 432.51 g/mol |
| Exact Mass | 432.14 |
| IUPAC Name | 5-methyl-3-[4-[3-methyl-8-(4-methylphenyl)-7,8-dihydro-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazepin-6-yl]phenyl]-1,3,4-oxadiazol-2-one |
| SMILES | Cc1ccc(C2CC(c3ccc(-n4nc(C)oc4=O)cc3)=Nn3c(C)nnc3S2)cc1 |
| InChI | InChI=1S/C22H20N6O2S/c1-13-4-6-17(7-5-13)20-12-19(26-27-14(2)23-24-21(27)31-20)16-8-10-18(11-9-16)28-22(29)30-15(3)25-28/h4-11,20H,12H2,1-3H3 |
| InChIKey | ZBDINXSORIQQKM-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 91.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.51 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |