C24H27NO7 — CID 11669376
(1R,12S,13R,17R)-3-(1,3-benzodioxol-5-ylmethyl)-7-methoxy-15,15-dimethyl-11,14,16,18-tetraoxa-3-azatetracyclo[10.6.0.04,9.013,17]octadeca-4(9),5,7-triene (PubChem CID 11669376) has the molecular formula C24H27NO7 and a molecular weight of 441.48 g/mol. Its IUPAC name is (1R,12S,13R,17R)-3-(1,3-benzodioxol-5-ylmethyl)-7-methoxy-15,15-dimethyl-11,14,16,18-tetraoxa-3-azatetracyclo[10.6.0.04,9.013,17]octadeca-4(9),5,7-triene.
| Compound Name | (1R,12S,13R,17R)-3-(1,3-benzodioxol-5-ylmethyl)-7-methoxy-15,15-dimethyl-11,14,16,18-tetraoxa-3-azatetracyclo[10.6.0.04,9.013,17]octadeca-4(9),5,7-triene |
|---|---|
| PubChem CID | 11669376 |
| Molecular Formula | C24H27NO7 |
| Molecular Weight | 441.48 g/mol |
| Exact Mass | 441.18 |
| IUPAC Name | (1R,12S,13R,17R)-3-(1,3-benzodioxol-5-ylmethyl)-7-methoxy-15,15-dimethyl-11,14,16,18-tetraoxa-3-azatetracyclo[10.6.0.04,9.013,17]octadeca-4(9),5,7-triene |
| SMILES | COc1ccc2c(c1)CO[C@@H]1[C@H]3OC(C)(C)O[C@H]3O[C@@H]1CN2Cc1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C24H27NO7/c1-24(2)31-22-21-20(30-23(22)32-24)11-25(10-14-4-7-18-19(8-14)29-13-28-18)17-6-5-16(26-3)9-15(17)12-27-21/h4-9,20-23H,10-13H2,1-3H3/t20-,21+,22-,23-/m1/s1 |
| InChIKey | WUDZZKRHAKJHAC-KAOXLYBCSA-N |
| XLogP | 3.21 |
| TPSA | 67.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.48 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|