C26H30O7 — CID 101492039
2-[(3aR,4S,7R,7aS)-4-(1,3-benzodioxol-5-yl)-7-[(4-methoxyphenyl)methoxy]-2,2-dimethyl-7,7a-dihydro-3aH-1,3-benzodioxol-4-yl]ethanol (PubChem CID 101492039) has the molecular formula C26H30O7 and a molecular weight of 454.52 g/mol. Its IUPAC name is 2-[(3aR,4S,7R,7aS)-4-(1,3-benzodioxol-5-yl)-7-[(4-methoxyphenyl)methoxy]-2,2-dimethyl-7,7a-dihydro-3aH-1,3-benzodioxol-4-yl]ethanol.
| Compound Name | 2-[(3aR,4S,7R,7aS)-4-(1,3-benzodioxol-5-yl)-7-[(4-methoxyphenyl)methoxy]-2,2-dimethyl-7,7a-dihydro-3aH-1,3-benzodioxol-4-yl]ethanol |
|---|---|
| PubChem CID | 101492039 |
| Molecular Formula | C26H30O7 |
| Molecular Weight | 454.52 g/mol |
| Exact Mass | 454.20 |
| IUPAC Name | 2-[(3aR,4S,7R,7aS)-4-(1,3-benzodioxol-5-yl)-7-[(4-methoxyphenyl)methoxy]-2,2-dimethyl-7,7a-dihydro-3aH-1,3-benzodioxol-4-yl]ethanol |
| SMILES | COc1ccc(CO[C@@H]2C=C[C@@](CCO)(c3ccc4c(c3)OCO4)[C@H]3OC(C)(C)O[C@@H]23)cc1 |
| InChI | InChI=1S/C26H30O7/c1-25(2)32-23-21(29-15-17-4-7-19(28-3)8-5-17)10-11-26(12-13-27,24(23)33-25)18-6-9-20-22(14-18)31-16-30-20/h4-11,14,21,23-24,27H,12-13,15-16H2,1-3H3/t21-,23+,24+,26-/m1/s1 |
| InChIKey | FRFPHTOEZWIEKK-BPEMXEAKSA-N |
| XLogP | 3.72 |
| TPSA | 75.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.52 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|