C18H24O6 — CID 11067674
(1R,12R,13R,17R)-6,7-dimethoxy-15,15-dimethyl-11,14,16,18-tetraoxatetracyclo[10.6.0.04,9.013,17]octadeca-4,6,8-triene (PubChem CID 11067674) has the molecular formula C18H24O6 and a molecular weight of 336.38 g/mol. Its IUPAC name is (1R,12R,13R,17R)-6,7-dimethoxy-15,15-dimethyl-11,14,16,18-tetraoxatetracyclo[10.6.0.04,9.013,17]octadeca-4,6,8-triene.
| Compound Name | (1R,12R,13R,17R)-6,7-dimethoxy-15,15-dimethyl-11,14,16,18-tetraoxatetracyclo[10.6.0.04,9.013,17]octadeca-4,6,8-triene |
|---|---|
| PubChem CID | 11067674 |
| Molecular Formula | C18H24O6 |
| Molecular Weight | 336.38 g/mol |
| Exact Mass | 336.16 |
| IUPAC Name | (1R,12R,13R,17R)-6,7-dimethoxy-15,15-dimethyl-11,14,16,18-tetraoxatetracyclo[10.6.0.04,9.013,17]octadeca-4,6,8-triene |
| SMILES | COc1cc2c(cc1OC)CO[C@H]1[C@H]3OC(C)(C)O[C@H]3O[C@@H]1CC2 |
| InChI | InChI=1S/C18H24O6/c1-18(2)23-16-15-12(22-17(16)24-18)6-5-10-7-13(19-3)14(20-4)8-11(10)9-21-15/h7-8,12,15-17H,5-6,9H2,1-4H3/t12-,15-,16-,17-/m1/s1 |
| InChIKey | GJWQQPMRPVSNAO-BASLNEPJSA-N |
| XLogP | 2.41 |
| TPSA | 55.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.38 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |