C19H26O5 — CID 102378954
(1R,13R,15S,16S,20S)-15-methoxy-18,18-dimethyl-2,14,17,19-tetraoxatetracyclo[11.7.0.04,9.016,20]icosa-4,6,8-triene (PubChem CID 102378954) has the molecular formula C19H26O5 and a molecular weight of 334.41 g/mol. Its IUPAC name is (1R,13R,15S,16S,20S)-15-methoxy-18,18-dimethyl-2,14,17,19-tetraoxatetracyclo[11.7.0.04,9.016,20]icosa-4,6,8-triene.
| Compound Name | (1R,13R,15S,16S,20S)-15-methoxy-18,18-dimethyl-2,14,17,19-tetraoxatetracyclo[11.7.0.04,9.016,20]icosa-4,6,8-triene |
|---|---|
| PubChem CID | 102378954 |
| Molecular Formula | C19H26O5 |
| Molecular Weight | 334.41 g/mol |
| Exact Mass | 334.18 |
| IUPAC Name | (1R,13R,15S,16S,20S)-15-methoxy-18,18-dimethyl-2,14,17,19-tetraoxatetracyclo[11.7.0.04,9.016,20]icosa-4,6,8-triene |
| SMILES | CO[C@H]1O[C@@H]2CCCc3ccccc3CO[C@H]2[C@@H]2OC(C)(C)O[C@H]12 |
| InChI | InChI=1S/C19H26O5/c1-19(2)23-16-15-14(22-18(20-3)17(16)24-19)10-6-9-12-7-4-5-8-13(12)11-21-15/h4-5,7-8,14-18H,6,9-11H2,1-3H3/t14-,15-,16+,17+,18+/m1/s1 |
| InChIKey | QKGUFRILTODOQX-ZBRFXRBCSA-N |
| XLogP | 2.80 |
| TPSA | 46.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.41 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |